Citric Acid
Medchemexpress LLC Licoricone | 51847-92-8 | 1 MG
Licoricone is a flavonoid extracted from licorice. It demonstrates anti-helicobacter pylori activity against CLAR and AMOX-resistant strains, as well as four CLAR (AMOX)-sensitive strains.
- Flavonoid extracted from licorice
- Demonstrates anti-Helicobacter pylori activity
- Effective against CLAR and AMOX-resistant strains
- Effective against CLAR (AMOX)-sensitive strains
eMolecules 1402666-29-8 | 2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599
2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC | 1402666-29-8281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599
![eMolecules 21461-84-7 | (S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422975.PNG-250.jpg)
eMolecules 21461-84-7 | (S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836
(S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | 21461-84-7 | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836
![eMolecules 62473-92-1 | Ambeed | 6-Bromobenzo[d]isothiazol-3(2H)-one 11-dioxide | 250mg | 525051189 | A141727 | MFCD03789731 | 262.08 | C7H4BrNO3S](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502485893.JPG-250.jpg)
eMolecules 62473-92-1 | Ambeed | 6-Bromobenzo[d]isothiazol-3(2H)-one 11-dioxide | 250mg | 525051189 | A141727 | MFCD03789731 | 262.08 | C7H4BrNO3S
Ambeed | 6-Bromobenzo[d]isothiazol-3(2H)-one 11-dioxide | 250mg | 525051189 | A141727 | 62473-92-1 | MFCD03789731 | 262.080 | C7H4BrNO3S
eMolecules 78056-60-7 | 1-Acetyl-4-piperidineacetic acid | Ambeed | MFCD12027293 | 185.223 | C9H15NO3 | 98.000 | CC(=O)N1CCC(CC(O)=O)CC1 | 250mg | 660581275
1-Acetyl-4-piperidineacetic acid | Ambeed | 78056-60-7 | MFCD12027293 | 185.223 | C9H15NO3 | 98.000 | CC(=O)N1CCC(CC(O)=O)CC1 | 250mg | 660581275
=O)C(=O)O1 | 1g | 649269522](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502430537.PNG-250.jpg)
eMolecules 113278-68-5 | (R)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic acid | Ambeed | MFCD00211272 | 174.152 | C7H10O5 | 95.000 | CC1(C)O[C@H](CC(O)=O)C(=O)O1 | 1g | 649269522
(R)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)acetic acid | Ambeed | 113278-68-5 | MFCD00211272 | 174.152 | C7H10O5 | 95.000 | CC1(C)O[C@H](CC(O)=O)C(=O)O1 | 1g | 649269522
eMolecules 1113-38-8 | Ambeed | Ammonium oxalate | 100g | 552536627 | A114144 | MFCD00013308 | 124.096 | C2H8N2O4
ChemScene | Oxazole-4-carbothioamide | 100mg | 569146536 | CS-0130151 | 118802-31-6 | MFCD06738920 | 128.150 | C4H4N2OS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 118133-15-6 | 1-(Ethoxycarbonyl)-4-piperidinecarboxylic Acid | Ambeed | MFCD07339354 | 201.222 | C9H15NO4 | 97.000 | CCOC(=O)N1CCC(CC1)C(O)=O | 1g | 525071923
1-(Ethoxycarbonyl)-4-piperidinecarboxylic Acid | Ambeed | 118133-15-6 | MFCD07339354 | 201.222 | C9H15NO4 | 97.000 | CCOC(=O)N1CCC(CC1)C(O)=O | 1g | 525071923
=O)C(C)(C)C | 1g | 534084845](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422644.JPG-250.jpg)
eMolecules 101968-85-8 | N-(tBu-carbamoyl)-tert-Leu-OH | Ambeed | MFCD12796012 | 230.308 | C11H22N2O3 | 98.000 | CC(C)(C)NC(=O)N[C@H](C(O)=O)C(C)(C)C | 1g | 534084845
N-(tBu-carbamoyl)-tert-Leu-OH | Ambeed | 101968-85-8 | MFCD12796012 | 230.308 | C11H22N2O3 | 98.000 | CC(C)(C)NC(=O)N[C@H](C(O)=O)C(C)(C)C | 1g | 534084845
eMolecules 25503-90-6 | 1-Acetyl-4-piperidinecarboxylic Acid | Ambeed | MFCD00023706 | 171.196 | C8H13NO3 | 95.000 | CC(=O)N1CCC(CC1)C(O)=O | 1g | 549151731
1-Acetyl-4-piperidinecarboxylic Acid | Ambeed | 25503-90-6 | MFCD00023706 | 171.196 | C8H13NO3 | 95.000 | CC(=O)N1CCC(CC1)C(O)=O | 1g | 549151731
Medchemexpress LLC Citric acid (tripotassium hydrate) | 6100-05-6 | 98.0% | 324.41 | 1 ML
Citric acid tripotassium hydrate is a natural preservative and food tartness enhancer. It induces apoptosis and cell cycle arrest at G2/M phase and S phase in HaCaT cells. This compound can also cause oxidative damage to the liver by decreasing antioxidative enzyme activities. Additionally, it functions as an acidulant, emulsifier, sequestrant, and buffering agent across various industries.
- Natural preservative and food tartness enhancer.
- Induces apoptosis and cell cycle arrest at G2/M phase and S phase in HaCaT cells.
- Causes oxidative damage of the liver by decreasing antioxidative enzyme activities.
- Acts as an acidulant, emulsifier, sequestrant, and buffering agent.
eMolecules 354-08-5 | Bromodifluoroacetic acid | Ambeed | MFCD02183519 | 174.929 | C2HBrF2O2 | 98.000 | OC(=O)C(F)(F)Br | 5g | 531648059
Bromodifluoroacetic acid | Ambeed | 354-08-5 | MFCD02183519 | 174.929 | C2HBrF2O2 | 98.000 | OC(=O)C(F)(F)Br | 5g | 531648059
eMolecules 1070-83-3 | 3,3-Dimethylbutyric acid | Ambeed | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
3,3-Dimethylbutyric acid | Ambeed | 1070-83-3 | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
Medchemexpress LLC HY-N1428 100mg Medchemexpress, Citric acid CAS:77-92-9 Purity:>98%
Medchemexpress, HY-N1428 100mg Citric acid CAS:77-92-9 Citric acid is a weak organic tricarboxylic acid found in citrus fruits. Citric acid is a natural preservative and food tartness enhancer. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.